C7H11NO — CID 152788471
2,3,3a,6,7,7a-hexahydro-1,3-benzoxazole (PubChem CID 152788471) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 2,3,3a,6,7,7a-hexahydro-1,3-benzoxazole.
| Compound Name | 2,3,3a,6,7,7a-hexahydro-1,3-benzoxazole |
|---|---|
| PubChem CID | 152788471 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 2,3,3a,6,7,7a-hexahydro-1,3-benzoxazole |
| SMILES | C1=CC2NCOC2CC1 |
| InChI | InChI=1S/C7H11NO/c1-2-4-7-6(3-1)8-5-9-7/h1,3,6-8H,2,4-5H2 |
| InChIKey | SDJBOTAQTYNHAY-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|