About (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium)
(2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) (PubChem CID 163954290) has the molecular formula C8H17NOY4
and a molecular weight of 498.85 g/mol. Its IUPAC name is (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium).
Molecular Properties
| Compound Name | (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) |
| PubChem CID | 163954290 |
| Molecular Formula | C8H17NOY4 |
| Molecular Weight | 498.85 g/mol |
| Exact Mass | 498.75 |
| IUPAC Name | (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) |
| SMILES | C=C(C)[C@H](CO)NC(C)C.[Y].[Y].[Y].[Y] |
| InChI | InChI=1S/C8H17NO.4Y/c1-6(2)8(5-10)9-7(3)4;;;;/h7-10H,1,5H2,2-4H3;;;;/t8-;;;;/m0..../s1 |
| InChIKey | CIOAELOEIUAKIT-USHJOAKVSA-N |
| XLogP | 0.91 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 498.85 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium)?
The IUPAC name of (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) (CID 163954290) is (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium).
What is the SMILES notation for (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium)?
The canonical SMILES for (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) is C=C(C)[C@H](CO)NC(C)C.[Y].[Y].[Y].[Y].
What is the InChIKey of (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium)?
The InChIKey is CIOAELOEIUAKIT-USHJOAKVSA-N. The full InChI is InChI=1S/C8H17NO.4Y/c1-6(2)8(5-10)9-7(3)4;;;;/h7-10H,1,5H2,2-4H3;;;;/t8-;;;;/m0..../s1.
What are the key properties of (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium)?
(2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) has a molecular weight of 498.85 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-3-methyl-2-(propan-2-ylamino)but-3-en-1-ol;tetrakis(yttrium) is sourced from PubChem (CID 163954290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).