C21H28O4S — CID 163954788
5-(4-methylsulfonylphenyl)-2-octylbenzene-1,3-diol (PubChem CID 163954788) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is 5-(4-methylsulfonylphenyl)-2-octylbenzene-1,3-diol.
| Compound Name | 5-(4-methylsulfonylphenyl)-2-octylbenzene-1,3-diol |
|---|---|
| PubChem CID | 163954788 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 5-(4-methylsulfonylphenyl)-2-octylbenzene-1,3-diol |
| SMILES | CCCCCCCCc1c(O)cc(-c2ccc(S(C)(=O)=O)cc2)cc1O |
| InChI | InChI=1S/C21H28O4S/c1-3-4-5-6-7-8-9-19-20(22)14-17(15-21(19)23)16-10-12-18(13-11-16)26(2,24)25/h10-15,22-23H,3-9H2,1-2H3 |
| InChIKey | TVSLCZVCWDQJIN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|