C9H14FN — CID 163955206
(Z,3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbut-1-en-1-amine (PubChem CID 163955206) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is (Z,3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbut-1-en-1-amine.
| Compound Name | (Z,3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbut-1-en-1-amine |
|---|---|
| PubChem CID | 163955206 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (Z,3R)-N-buta-1,3-dien-2-yl-3-fluoro-2-methylbut-1-en-1-amine |
| SMILES | C=CC(=C)N/C=C(/C)[C@@H](C)F |
| InChI | InChI=1S/C9H14FN/c1-5-8(3)11-6-7(2)9(4)10/h5-6,9,11H,1,3H2,2,4H3/b7-6-/t9-/m1/s1 |
| InChIKey | SCTIMDAOAQGHIE-ATJFRQLMSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|