C10H14FN — CID 142956605
(3Z)-5-fluoro-2-methylidene-N-prop-1-en-2-ylhexa-3,5-dien-1-amine (PubChem CID 142956605) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is (3Z)-5-fluoro-2-methylidene-N-prop-1-en-2-ylhexa-3,5-dien-1-amine.
| Compound Name | (3Z)-5-fluoro-2-methylidene-N-prop-1-en-2-ylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 142956605 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | (3Z)-5-fluoro-2-methylidene-N-prop-1-en-2-ylhexa-3,5-dien-1-amine |
| SMILES | C=C(F)/C=C\C(=C)CNC(=C)C |
| InChI | InChI=1S/C10H14FN/c1-8(2)12-7-9(3)5-6-10(4)11/h5-6,12H,1,3-4,7H2,2H3/b6-5- |
| InChIKey | JTTBEKMXGPPDTI-WAYWQWQTSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|