C24H30N5O4+ — CID 163955306
[(Z)-1-[[3-[[6-(azetidine-1-carbonyl)-3-pyridinyl]oxy]-5-[(2S)-butan-2-yl]oxybenzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium (PubChem CID 163955306) has the molecular formula C24H30N5O4+ and a molecular weight of 452.54 g/mol. Its IUPAC name is [(Z)-1-[[3-[[6-(azetidine-1-carbonyl)-3-pyridinyl]oxy]-5-[(2S)-butan-2-yl]oxybenzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium.
| Compound Name | [(Z)-1-[[3-[[6-(azetidine-1-carbonyl)-3-pyridinyl]oxy]-5-[(2S)-butan-2-yl]oxybenzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 163955306 |
| Molecular Formula | C24H30N5O4+ |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [(Z)-1-[[3-[[6-(azetidine-1-carbonyl)-3-pyridinyl]oxy]-5-[(2S)-butan-2-yl]oxybenzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium |
| SMILES | CC[C@H](C)Oc1cc(Oc2ccc(C(=O)N3CCC3)nc2)cc(C(=O)NC(=[NH2+])/C=C\NC)c1 |
| InChI | InChI=1S/C24H29N5O4/c1-4-16(2)32-19-12-17(23(30)28-22(25)8-9-26-3)13-20(14-19)33-18-6-7-21(27-15-18)24(31)29-10-5-11-29/h6-9,12-16,26H,4-5,10-11H2,1-3H3,(H2,25,28,30)/p+1/b9-8-/t16-/m0/s1 |
| InChIKey | SCVGCYPWFFGPPW-QWGSZXSUSA-O |
| XLogP | 1.52 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|