C22H27N4O5+ — CID 143406453
[(Z)-1-[[3-(4-carbamoylphenoxy)-5-(3-hydroxybutan-2-yloxy)benzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium (PubChem CID 143406453) has the molecular formula C22H27N4O5+ and a molecular weight of 427.48 g/mol. Its IUPAC name is [(Z)-1-[[3-(4-carbamoylphenoxy)-5-(3-hydroxybutan-2-yloxy)benzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium.
| Compound Name | [(Z)-1-[[3-(4-carbamoylphenoxy)-5-(3-hydroxybutan-2-yloxy)benzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium |
|---|---|
| PubChem CID | 143406453 |
| Molecular Formula | C22H27N4O5+ |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | [(Z)-1-[[3-(4-carbamoylphenoxy)-5-(3-hydroxybutan-2-yloxy)benzoyl]amino]-3-(methylamino)prop-2-enylidene]azanium |
| SMILES | CN/C=C\C(=[NH2+])NC(=O)c1cc(Oc2ccc(C(N)=O)cc2)cc(OC(C)C(C)O)c1 |
| InChI | InChI=1S/C22H26N4O5/c1-13(27)14(2)30-18-10-16(22(29)26-20(23)8-9-25-3)11-19(12-18)31-17-6-4-15(5-7-17)21(24)28/h4-14,25,27H,1-3H3,(H2,24,28)(H2,23,26,29)/p+1/b9-8- |
| InChIKey | LICOBQDBZYZGLB-HJWRWDBZSA-O |
| XLogP | 0.35 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|