C52H42N2 — CID 163956469
2-[6-[4-[2,6-dimethyl-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-9-ethylcarbazol-3-yl]-2-methylpropanenitrile (PubChem CID 163956469) has the molecular formula C52H42N2 and a molecular weight of 694.92 g/mol. Its IUPAC name is 2-[6-[4-[2,6-dimethyl-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-9-ethylcarbazol-3-yl]-2-methylpropanenitrile.
| Compound Name | 2-[6-[4-[2,6-dimethyl-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-9-ethylcarbazol-3-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 163956469 |
| Molecular Formula | C52H42N2 |
| Molecular Weight | 694.92 g/mol |
| Exact Mass | 694.33 |
| IUPAC Name | 2-[6-[4-[2,6-dimethyl-10-(4-phenylphenyl)anthracen-9-yl]phenyl]-9-ethylcarbazol-3-yl]-2-methylpropanenitrile |
| SMILES | CCn1c2ccc(-c3ccc(-c4c5ccc(C)cc5c(-c5ccc(-c6ccccc6)cc5)c5ccc(C)cc45)cc3)cc2c2cc(C(C)(C)C#N)ccc21 |
| InChI | InChI=1S/C52H42N2/c1-6-54-48-26-22-40(30-44(48)45-31-41(23-27-49(45)54)52(4,5)32-53)37-16-20-39(21-17-37)51-43-25-13-33(2)28-46(43)50(42-24-12-34(3)29-47(42)51)38-18-14-36(15-19-38)35-10-8-7-9-11-35/h7-31H,6H2,1-5H3 |
| InChIKey | SDUHBCXYRFPDNT-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.92 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|