C23H46N2O6 — CID 163957806
6-[[3-(6-aminohexoxy)-3,9-diethyl-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxy]hexan-1-amine (PubChem CID 163957806) has the molecular formula C23H46N2O6 and a molecular weight of 446.63 g/mol. Its IUPAC name is 6-[[3-(6-aminohexoxy)-3,9-diethyl-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxy]hexan-1-amine.
| Compound Name | 6-[[3-(6-aminohexoxy)-3,9-diethyl-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxy]hexan-1-amine |
|---|---|
| PubChem CID | 163957806 |
| Molecular Formula | C23H46N2O6 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 6-[[3-(6-aminohexoxy)-3,9-diethyl-2,4,8,10-tetraoxaspiro[5.5]undecan-9-yl]oxy]hexan-1-amine |
| SMILES | CCC1(OCCCCCCN)OCC2(CO1)COC(CC)(OCCCCCCN)OC2 |
| InChI | InChI=1S/C23H46N2O6/c1-3-22(26-15-11-7-5-9-13-24)28-17-21(18-29-22)19-30-23(4-2,31-20-21)27-16-12-8-6-10-14-25/h3-20,24-25H2,1-2H3 |
| InChIKey | SEXRLCFTUHLGFA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|