About 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane
2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane (PubChem CID 163958055) has the molecular formula C24H32N2O
and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane.
Molecular Properties
| Compound Name | 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane |
| PubChem CID | 163958055 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane |
| SMILES | COc1ccc(-c2ccc(C3(C4CCCCC4)NCC(C)CN3)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O/c1-18-16-25-24(26-17-18,21-6-4-3-5-7-21)22-12-8-19(9-13-22)20-10-14-23(27-2)15-11-20/h8-15,18,21,25-26H,3-7,16-17H2,1-2H3 |
| InChIKey | SFCWOLIEBWNRRS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane?
The IUPAC name of 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane (CID 163958055) is 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane.
What is the SMILES notation for 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane?
The canonical SMILES for 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane is COc1ccc(-c2ccc(C3(C4CCCCC4)NCC(C)CN3)cc2)cc1.
What is the InChIKey of 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane?
The InChIKey is SFCWOLIEBWNRRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H32N2O/c1-18-16-25-24(26-17-18,21-6-4-3-5-7-21)22-12-8-19(9-13-22)20-10-14-23(27-2)15-11-20/h8-15,18,21,25-26H,3-7,16-17H2,1-2H3.
What are the key properties of 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane?
2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane has a molecular weight of 364.53 g/mol, XLogP of 4.92, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane is sourced from PubChem (CID 163958055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).