C24H32N2O — CID 163958055
2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane (PubChem CID 163958055) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane.
| Compound Name | 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane |
|---|---|
| PubChem CID | 163958055 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | 2-cyclohexyl-2-[4-(4-methoxyphenyl)phenyl]-5-methyl-1,3-diazinane |
| SMILES | COc1ccc(-c2ccc(C3(C4CCCCC4)NCC(C)CN3)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O/c1-18-16-25-24(26-17-18,21-6-4-3-5-7-21)22-12-8-19(9-13-22)20-10-14-23(27-2)15-11-20/h8-15,18,21,25-26H,3-7,16-17H2,1-2H3 |
| InChIKey | SFCWOLIEBWNRRS-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |