C20H14N3O- — CID 163958266
12-oxido-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-8,16-diamine (PubChem CID 163958266) has the molecular formula C20H14N3O- and a molecular weight of 312.35 g/mol. Its IUPAC name is 12-oxido-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-8,16-diamine.
| Compound Name | 12-oxido-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-8,16-diamine |
|---|---|
| PubChem CID | 163958266 |
| Molecular Formula | C20H14N3O- |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 12-oxido-12-azapentacyclo[11.8.0.02,11.05,10.014,19]henicosa-1(13),2(11),3,5(10),6,8,14(19),15,17,20-decaene-8,16-diamine |
| SMILES | Nc1ccc2ccc3c4ccc5ccc(N)cc5c4n([O-])c3c2c1 |
| InChI | InChI=1S/C20H14N3O/c21-13-5-1-11-3-7-15-16-8-4-12-2-6-14(22)10-18(12)20(16)23(24)19(15)17(11)9-13/h1-10H,21-22H2/q-1 |
| InChIKey | QTJWAXXBJPMZTG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|