C21H24N2OS — CID 163963555
(4R)-4-ethynyl-3-isocyano-4-methyl-6,7-dihydro-5H-1-benzothiophen-2-amine;(2R)-2-ethynyl-2-methylcyclohexan-1-one (PubChem CID 163963555) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is (4R)-4-ethynyl-3-isocyano-4-methyl-6,7-dihydro-5H-1-benzothiophen-2-amine;(2R)-2-ethynyl-2-methylcyclohexan-1-one.
| Compound Name | (4R)-4-ethynyl-3-isocyano-4-methyl-6,7-dihydro-5H-1-benzothiophen-2-amine;(2R)-2-ethynyl-2-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 163963555 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (4R)-4-ethynyl-3-isocyano-4-methyl-6,7-dihydro-5H-1-benzothiophen-2-amine;(2R)-2-ethynyl-2-methylcyclohexan-1-one |
| SMILES | C#C[C@@]1(C)CCCCC1=O.[C-]#[N+]c1c(N)sc2c1[C@@](C)(C#C)CCC2 |
| InChI | InChI=1S/C12H12N2S.C9H12O/c1-4-12(2)7-5-6-8-9(12)10(14-3)11(13)15-8;1-3-9(2)7-5-4-6-8(9)10/h1H,5-7,13H2,2H3;1H,4-7H2,2H3/t12-;9-/m00/s1 |
| InChIKey | SJQFNYKLCCFHSU-MATWGEPFSA-N |
| XLogP | 4.88 |
| TPSA | 47.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|