C33H52N2OSSi2 — CID 163671836
(5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine;(2R)-2-methyl-2-(2-triethylsilylethynyl)cyclohexan-1-one (PubChem CID 163671836) has the molecular formula C33H52N2OSSi2 and a molecular weight of 581.03 g/mol. Its IUPAC name is (5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine;(2R)-2-methyl-2-(2-triethylsilylethynyl)cyclohexan-1-one.
| Compound Name | (5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine;(2R)-2-methyl-2-(2-triethylsilylethynyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 163671836 |
| Molecular Formula | C33H52N2OSSi2 |
| Molecular Weight | 581.03 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | (5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine;(2R)-2-methyl-2-(2-triethylsilylethynyl)cyclohexan-1-one |
| SMILES | CC[Si](C#C[C@@]1(C)CCCCC1=O)(CC)CC.[C-]#[N+]c1c(N)sc2c1C[C@@](C)(C#C[Si](CC)(CC)CC)CC2 |
| InChI | InChI=1S/C18H26N2SSi.C15H26OSi/c1-6-22(7-2,8-3)12-11-18(4)10-9-15-14(13-18)16(20-5)17(19)21-15;1-5-17(6-2,7-3)13-12-15(4)11-9-8-10-14(15)16/h6-10,13,19H2,1-4H3;5-11H2,1-4H3/t18-;15-/m11/s1 |
| InChIKey | JDFOSGPFORWMRK-GNPGSHRGSA-N |
| XLogP | 9.61 |
| TPSA | 47.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.03 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|