C18H26N2SSi — CID 162494748
(5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine (PubChem CID 162494748) has the molecular formula C18H26N2SSi and a molecular weight of 330.57 g/mol. Its IUPAC name is (5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine.
| Compound Name | (5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine |
|---|---|
| PubChem CID | 162494748 |
| Molecular Formula | C18H26N2SSi |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (5S)-3-isocyano-5-methyl-5-(2-triethylsilylethynyl)-6,7-dihydro-4H-1-benzothiophen-2-amine |
| SMILES | [C-]#[N+]c1c(N)sc2c1C[C@@](C)(C#C[Si](CC)(CC)CC)CC2 |
| InChI | InChI=1S/C18H26N2SSi/c1-6-22(7-2,8-3)12-11-18(4)10-9-15-14(13-18)16(20-5)17(19)21-15/h6-10,13,19H2,1-4H3/t18-/m1/s1 |
| InChIKey | QJNRXJLTTHBAAP-GOSISDBHSA-N |
| XLogP | 5.43 |
| TPSA | 30.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|