C21H31N3SSi — CID 162494690
N'-[(4R)-3-isocyano-4-methyl-4-(2-triethylsilylethynyl)-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 162494690) has the molecular formula C21H31N3SSi and a molecular weight of 385.65 g/mol. Its IUPAC name is N'-[(4R)-3-isocyano-4-methyl-4-(2-triethylsilylethynyl)-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[(4R)-3-isocyano-4-methyl-4-(2-triethylsilylethynyl)-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 162494690 |
| Molecular Formula | C21H31N3SSi |
| Molecular Weight | 385.65 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N'-[(4R)-3-isocyano-4-methyl-4-(2-triethylsilylethynyl)-6,7-dihydro-5H-1-benzothiophen-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | [C-]#[N+]c1c(/N=C/N(C)C)sc2c1[C@@](C)(C#C[Si](CC)(CC)CC)CCC2 |
| InChI | InChI=1S/C21H31N3SSi/c1-8-26(9-2,10-3)15-14-21(4)13-11-12-17-18(21)19(22-5)20(25-17)23-16-24(6)7/h16H,8-13H2,1-4,6-7H3/b23-16+/t21-/m1/s1 |
| InChIKey | ZAUQSDJMDYJCPY-BQNPTPDXSA-N |
| XLogP | 6.17 |
| TPSA | 19.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.65 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|