About 2-cyclohexa-2,4-dien-1-ylbenzotriazole
2-cyclohexa-2,4-dien-1-ylbenzotriazole (PubChem CID 163963893) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-ylbenzotriazole.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-ylbenzotriazole |
| PubChem CID | 163963893 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-ylbenzotriazole |
| SMILES | C1=CCC(n2nc3ccccc3n2)C=C1 |
| InChI | InChI=1S/C12H11N3/c1-2-6-10(7-3-1)15-13-11-8-4-5-9-12(11)14-15/h1-6,8-10H,7H2 |
| InChIKey | SJYBGOUKCOVKDB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclohexa-2,4-dien-1-ylbenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-ylbenzotriazole?
The IUPAC name of 2-cyclohexa-2,4-dien-1-ylbenzotriazole (CID 163963893) is 2-cyclohexa-2,4-dien-1-ylbenzotriazole.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-ylbenzotriazole?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-ylbenzotriazole is C1=CCC(n2nc3ccccc3n2)C=C1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-ylbenzotriazole?
The InChIKey is SJYBGOUKCOVKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-2-6-10(7-3-1)15-13-11-8-4-5-9-12(11)14-15/h1-6,8-10H,7H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-ylbenzotriazole?
2-cyclohexa-2,4-dien-1-ylbenzotriazole has a molecular weight of 197.24 g/mol, XLogP of 2.49, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-ylbenzotriazole is sourced from PubChem (CID 163963893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).