C8H10F3NS — CID 163965313
2,2,2-trifluoro-N-methyl-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine (PubChem CID 163965313) has the molecular formula C8H10F3NS and a molecular weight of 209.24 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine.
| Compound Name | 2,2,2-trifluoro-N-methyl-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine |
|---|---|
| PubChem CID | 163965313 |
| Molecular Formula | C8H10F3NS |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine |
| SMILES | C/N=C(/C1SC=CC1C)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NS/c1-5-3-4-13-6(5)7(12-2)8(9,10)11/h3-6H,1-2H3/b12-7- |
| InChIKey | SLEKUNXDZSNPRO-GHXNOFRVSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|