C7H8F3NS — CID 158862848
2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine (PubChem CID 158862848) has the molecular formula C7H8F3NS and a molecular weight of 195.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine.
| Compound Name | 2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine |
|---|---|
| PubChem CID | 158862848 |
| Molecular Formula | C7H8F3NS |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-methyl-2,3-dihydrothiophen-2-yl)ethanimine |
| SMILES | [H]/N=C(/C1SC=CC1C)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NS/c1-4-2-3-12-5(4)6(11)7(8,9)10/h2-5,11H,1H3/b11-6- |
| InChIKey | JAVZVADSIRLBCS-WDZFZDKYSA-N |
| XLogP | 2.83 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|