C29H31Cl2FN2O4 — CID 163966768
methyl 3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorophenyl]propanoate (PubChem CID 163966768) has the molecular formula C29H31Cl2FN2O4 and a molecular weight of 561.48 g/mol. Its IUPAC name is methyl 3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorophenyl]propanoate.
| Compound Name | methyl 3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorophenyl]propanoate |
|---|---|
| PubChem CID | 163966768 |
| Molecular Formula | C29H31Cl2FN2O4 |
| Molecular Weight | 561.48 g/mol |
| Exact Mass | 560.16 |
| IUPAC Name | methyl 3-[4-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-4,5-dihydro-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorophenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(N2C[C@@H]3C[C@H]2C[C@H]3OCC2C(c3c(Cl)cccc3Cl)=NOC2C2CC2)cc1F |
| InChI | InChI=1S/C29H31Cl2FN2O4/c1-36-26(35)10-8-16-7-9-19(12-24(16)32)34-14-18-11-20(34)13-25(18)37-15-21-28(33-38-29(21)17-5-6-17)27-22(30)3-2-4-23(27)31/h2-4,7,9,12,17-18,20-21,25,29H,5-6,8,10-11,13-15H2,1H3/t18-,20-,21?,25+,29?/m0/s1 |
| InChIKey | SMMBIXUSMIKIBT-FWPKMOPKSA-N |
| XLogP | 6.05 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |