C20H19BrN4O3 — CID 163966841
3-[[2-(5-bromo-2-hydroxyphenyl)acetyl]amino]-N-(1-imino-2-methanimidoylbut-3-en-2-yl)benzamide (PubChem CID 163966841) has the molecular formula C20H19BrN4O3 and a molecular weight of 443.30 g/mol. Its IUPAC name is 3-[[2-(5-bromo-2-hydroxyphenyl)acetyl]amino]-N-(1-imino-2-methanimidoylbut-3-en-2-yl)benzamide.
| Compound Name | 3-[[2-(5-bromo-2-hydroxyphenyl)acetyl]amino]-N-(1-imino-2-methanimidoylbut-3-en-2-yl)benzamide |
|---|---|
| PubChem CID | 163966841 |
| Molecular Formula | C20H19BrN4O3 |
| Molecular Weight | 443.30 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 3-[[2-(5-bromo-2-hydroxyphenyl)acetyl]amino]-N-(1-imino-2-methanimidoylbut-3-en-2-yl)benzamide |
| SMILES | [H]/N=C/C(C=C)(/C=N/[H])NC(=O)c1cccc(NC(=O)Cc2cc(Br)ccc2O)c1 |
| InChI | InChI=1S/C20H19BrN4O3/c1-2-20(11-22,12-23)25-19(28)13-4-3-5-16(9-13)24-18(27)10-14-8-15(21)6-7-17(14)26/h2-9,11-12,22-23,26H,1,10H2,(H,24,27)(H,25,28)/b22-11+,23-12+ |
| InChIKey | SMNIBLGHILXODK-LCHFAGMQSA-N |
| XLogP | 3.29 |
| TPSA | 126.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|