C8H14N4 — CID 163967016
3-amino-N-ethylidene-N'-methanimidoyl-2-methylbut-2-enimidamide (PubChem CID 163967016) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 3-amino-N-ethylidene-N'-methanimidoyl-2-methylbut-2-enimidamide.
| Compound Name | 3-amino-N-ethylidene-N'-methanimidoyl-2-methylbut-2-enimidamide |
|---|---|
| PubChem CID | 163967016 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 3-amino-N-ethylidene-N'-methanimidoyl-2-methylbut-2-enimidamide |
| SMILES | [H]/N=C/N=C(\N=C\C)C(C)=C(C)N |
| InChI | InChI=1S/C8H14N4/c1-4-11-8(12-5-9)6(2)7(3)10/h4-5,9H,10H2,1-3H3/b7-6?,9-5+,11-4+,12-8- |
| InChIKey | ILLODOBMNBUUBG-NKUUQFJRSA-N |
| XLogP | 1.34 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|