C19H24F5N5O — CID 163967849
(3R)-3-amino-4-(2,5-difluorophenyl)-1-[3,9-dimethyl-3-(trifluoromethyl)-5,6,7,9-tetrahydro-2H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]butan-1-one (PubChem CID 163967849) has the molecular formula C19H24F5N5O and a molecular weight of 433.43 g/mol. Its IUPAC name is (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3,9-dimethyl-3-(trifluoromethyl)-5,6,7,9-tetrahydro-2H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]butan-1-one.
| Compound Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3,9-dimethyl-3-(trifluoromethyl)-5,6,7,9-tetrahydro-2H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]butan-1-one |
|---|---|
| PubChem CID | 163967849 |
| Molecular Formula | C19H24F5N5O |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (3R)-3-amino-4-(2,5-difluorophenyl)-1-[3,9-dimethyl-3-(trifluoromethyl)-5,6,7,9-tetrahydro-2H-[1,2,4]triazolo[4,3-a][1,4]diazepin-8-yl]butan-1-one |
| SMILES | CC1C2=NNC(C)(C(F)(F)F)N2CCCN1C(=O)C[C@H](N)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C19H24F5N5O/c1-11-17-26-27-18(2,19(22,23)24)29(17)7-3-6-28(11)16(30)10-14(25)9-12-8-13(20)4-5-15(12)21/h4-5,8,11,14,27H,3,6-7,9-10,25H2,1-2H3/t11?,14-,18?/m1/s1 |
| InChIKey | SNJQTBGCSZSECK-NDBLMLTRSA-N |
| XLogP | 2.34 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |