C39H34BN3O3 — CID 163968569
2-phenyl-6-(4-phenylphenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]-1,4-dihydro-1,3,5-triazine (PubChem CID 163968569) has the molecular formula C39H34BN3O3 and a molecular weight of 603.53 g/mol. Its IUPAC name is 2-phenyl-6-(4-phenylphenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-phenyl-6-(4-phenylphenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 163968569 |
| Molecular Formula | C39H34BN3O3 |
| Molecular Weight | 603.53 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | 2-phenyl-6-(4-phenylphenyl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-4-yl]-1,4-dihydro-1,3,5-triazine |
| SMILES | CC1(C)OB(c2cc(C3N=C(c4ccccc4)NC(c4ccc(-c5ccccc5)cc4)=N3)c3oc4ccccc4c3c2)OC1(C)C |
| InChI | InChI=1S/C39H34BN3O3/c1-38(2)39(3,4)46-40(45-38)29-23-31-30-17-11-12-18-33(30)44-34(31)32(24-29)37-42-35(27-15-9-6-10-16-27)41-36(43-37)28-21-19-26(20-22-28)25-13-7-5-8-14-25/h5-24,37H,1-4H3,(H,41,42,43) |
| InChIKey | SNZHFXOKFPDDSF-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.53 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|