C23H21IN2O2 — CID 163970431
N-(3-iodophenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]oxamide (PubChem CID 163970431) has the molecular formula C23H21IN2O2 and a molecular weight of 484.34 g/mol. Its IUPAC name is N-(3-iodophenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]oxamide.
| Compound Name | N-(3-iodophenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]oxamide |
|---|---|
| PubChem CID | 163970431 |
| Molecular Formula | C23H21IN2O2 |
| Molecular Weight | 484.34 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | N-(3-iodophenyl)-N'-[2-(4-methylphenyl)-1-phenylethyl]oxamide |
| SMILES | Cc1ccc(CC(NC(=O)C(=O)Nc2cccc(I)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21IN2O2/c1-16-10-12-17(13-11-16)14-21(18-6-3-2-4-7-18)26-23(28)22(27)25-20-9-5-8-19(24)15-20/h2-13,15,21H,14H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | PUXXFCLFOPOAQS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|