C25H33NO — CID 54296875
4,4,5,5-tetramethyl-N-[2-(4-methylphenyl)-1-phenylethyl]hex-2-enamide (PubChem CID 54296875) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-N-[2-(4-methylphenyl)-1-phenylethyl]hex-2-enamide.
| Compound Name | 4,4,5,5-tetramethyl-N-[2-(4-methylphenyl)-1-phenylethyl]hex-2-enamide |
|---|---|
| PubChem CID | 54296875 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-N-[2-(4-methylphenyl)-1-phenylethyl]hex-2-enamide |
| SMILES | Cc1ccc(CC(NC(=O)C=CC(C)(C)C(C)(C)C)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H33NO/c1-19-12-14-20(15-13-19)18-22(21-10-8-7-9-11-21)26-23(27)16-17-25(5,6)24(2,3)4/h7-17,22H,18H2,1-6H3,(H,26,27) |
| InChIKey | SBJVJBUHUMIHDC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|