C41H27INO2PS — CID 163973887
8-[8-(5-diphenylphosphoryl-1-methylidene-1λ5-iodacyclohexa-1,3,5-trien-3-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]pyridine (PubChem CID 163973887) has the molecular formula C41H27INO2PS and a molecular weight of 755.62 g/mol. Its IUPAC name is 8-[8-(5-diphenylphosphoryl-1-methylidene-1λ5-iodacyclohexa-1,3,5-trien-3-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]pyridine.
| Compound Name | 8-[8-(5-diphenylphosphoryl-1-methylidene-1λ5-iodacyclohexa-1,3,5-trien-3-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]pyridine |
|---|---|
| PubChem CID | 163973887 |
| Molecular Formula | C41H27INO2PS |
| Molecular Weight | 755.62 g/mol |
| Exact Mass | 755.05 |
| IUPAC Name | 8-[8-(5-diphenylphosphoryl-1-methylidene-1λ5-iodacyclohexa-1,3,5-trien-3-yl)dibenzothiophen-2-yl]-[1]benzofuro[3,2-c]pyridine |
| SMILES | C=I1=CC(c2ccc3sc4ccc(-c5ccc6oc7ccncc7c6c5)cc4c3c2)=CC(P(=O)(c2ccccc2)c2ccccc2)=C1 |
| InChI | InChI=1S/C41H27INO2PS/c1-42-24-30(20-33(25-42)46(44,31-8-4-2-5-9-31)32-10-6-3-7-11-32)29-14-17-41-36(23-29)35-22-28(13-16-40(35)47-41)27-12-15-38-34(21-27)37-26-43-19-18-39(37)45-38/h2-26H,1H2 |
| InChIKey | SSJWBXJFYYGINB-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.62 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|