C39H24N2O2S — CID 144553574
[5-[3-[8-([1]benzofuro[3,2-c]pyridin-8-yl)dibenzothiophen-2-yl]phenyl]-2-methyl-1-benzofuran-3-yl]methanimine (PubChem CID 144553574) has the molecular formula C39H24N2O2S and a molecular weight of 584.70 g/mol. Its IUPAC name is [5-[3-[8-([1]benzofuro[3,2-c]pyridin-8-yl)dibenzothiophen-2-yl]phenyl]-2-methyl-1-benzofuran-3-yl]methanimine.
| Compound Name | [5-[3-[8-([1]benzofuro[3,2-c]pyridin-8-yl)dibenzothiophen-2-yl]phenyl]-2-methyl-1-benzofuran-3-yl]methanimine |
|---|---|
| PubChem CID | 144553574 |
| Molecular Formula | C39H24N2O2S |
| Molecular Weight | 584.70 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | [5-[3-[8-([1]benzofuro[3,2-c]pyridin-8-yl)dibenzothiophen-2-yl]phenyl]-2-methyl-1-benzofuran-3-yl]methanimine |
| SMILES | [H]/N=C/c1c(C)oc2ccc(-c3cccc(-c4ccc5sc6ccc(-c7ccc8oc9ccncc9c8c7)cc6c5c4)c3)cc12 |
| InChI | InChI=1S/C39H24N2O2S/c1-22-33(20-40)29-16-25(5-9-35(29)42-22)23-3-2-4-24(15-23)27-7-11-38-31(18-27)32-19-28(8-12-39(32)44-38)26-6-10-36-30(17-26)34-21-41-14-13-37(34)43-36/h2-21,40H,1H3/b40-20+ |
| InChIKey | ZIFOEYYUJYHTKF-KPRPFPDJSA-N |
| XLogP | 11.40 |
| TPSA | 63.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.70 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|