C26H27IN7O2- — CID 163974350
CID 163974350 (PubChem CID 163974350) has the molecular formula C26H27IN7O2- and a molecular weight of 596.45 g/mol.
| Compound Name | CID 163974350 |
|---|---|
| PubChem CID | 163974350 |
| Molecular Formula | C26H27IN7O2- |
| Molecular Weight | 596.45 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | — |
| SMILES | NC(=O)c1c(-c2cnn(Cc3ccccc3)c2)nn(C2CC3(CCN(C(=O)C#CC4CC4)[I-]3)C2)c1N |
| InChI | InChI=1S/C26H27IN7O2/c28-24-22(25(29)36)23(19-14-30-32(16-19)15-18-4-2-1-3-5-18)31-34(24)20-12-26(13-20)10-11-33(27-26)21(35)9-8-17-6-7-17/h1-5,14,16-17,20H,6-7,10-13,15,28H2,(H2,29,36)/q-1 |
| InChIKey | CXBIHNNSJQIMNT-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.45 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|