C24H24F3N7O2 — CID 129259124
5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide (PubChem CID 129259124) has the molecular formula C24H24F3N7O2 and a molecular weight of 499.50 g/mol. Its IUPAC name is 5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129259124 |
| Molecular Formula | C24H24F3N7O2 |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[1-[[4-(trifluoromethyl)phenyl]methyl]pyrazol-4-yl]pyrazole-4-carboxamide |
| SMILES | CC#CC(=O)N1CCC(n2nc(-c3cnn(Cc4ccc(C(F)(F)F)cc4)c3)c(C(N)=O)c2N)CC1 |
| InChI | InChI=1S/C24H24F3N7O2/c1-2-3-19(35)32-10-8-18(9-11-32)34-22(28)20(23(29)36)21(31-34)16-12-30-33(14-16)13-15-4-6-17(7-5-15)24(25,26)27/h4-7,12,14,18H,8-11,13,28H2,1H3,(H2,29,36) |
| InChIKey | POWJTNKFOBGKRJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 125.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|