C20H20F3N5O2 — CID 123581302
5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 123581302) has the molecular formula C20H20F3N5O2 and a molecular weight of 419.41 g/mol. Its IUPAC name is 5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123581302 |
| Molecular Formula | C20H20F3N5O2 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 5-amino-1-(1-but-2-ynoylpiperidin-4-yl)-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | CC#CC(=O)N1CCC(n2nc(-c3ccc(C(F)(F)F)cc3)c(C(N)=O)c2N)CC1 |
| InChI | InChI=1S/C20H20F3N5O2/c1-2-3-15(29)27-10-8-14(9-11-27)28-18(24)16(19(25)30)17(26-28)12-4-6-13(7-5-12)20(21,22)23/h4-7,14H,8-11,24H2,1H3,(H2,25,30) |
| InChIKey | OPXDIEULNLQSHJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|