C24H27F4N5O3 — CID 123938179
5-amino-1-(1-but-2-ynoylazonan-5-yl)-3-[4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 123938179) has the molecular formula C24H27F4N5O3 and a molecular weight of 509.50 g/mol. Its IUPAC name is 5-amino-1-(1-but-2-ynoylazonan-5-yl)-3-[4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-(1-but-2-ynoylazonan-5-yl)-3-[4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123938179 |
| Molecular Formula | C24H27F4N5O3 |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 5-amino-1-(1-but-2-ynoylazonan-5-yl)-3-[4-fluoro-3-(2,2,2-trifluoroethoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | CC#CC(=O)N1CCCCC(n2nc(-c3ccc(F)c(OCC(F)(F)F)c3)c(C(N)=O)c2N)CCC1 |
| InChI | InChI=1S/C24H27F4N5O3/c1-2-6-19(34)32-11-4-3-7-16(8-5-12-32)33-22(29)20(23(30)35)21(31-33)15-9-10-17(25)18(13-15)36-14-24(26,27)28/h9-10,13,16H,3-5,7-8,11-12,14,29H2,1H3,(H2,30,35) |
| InChIKey | DNXYLPMHESFSNK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|