C21H24F3N5O2 — CID 138549790
5-amino-1-[(4S)-1-prop-2-enoylazocan-4-yl]-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide (PubChem CID 138549790) has the molecular formula C21H24F3N5O2 and a molecular weight of 435.45 g/mol. Its IUPAC name is 5-amino-1-[(4S)-1-prop-2-enoylazocan-4-yl]-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[(4S)-1-prop-2-enoylazocan-4-yl]-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 138549790 |
| Molecular Formula | C21H24F3N5O2 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 5-amino-1-[(4S)-1-prop-2-enoylazocan-4-yl]-3-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCCC[C@H](n2nc(-c3ccc(C(F)(F)F)cc3)c(C(N)=O)c2N)CC1 |
| InChI | InChI=1S/C21H24F3N5O2/c1-2-16(30)28-11-4-3-5-15(10-12-28)29-19(25)17(20(26)31)18(27-29)13-6-8-14(9-7-13)21(22,23)24/h2,6-9,15H,1,3-5,10-12,25H2,(H2,26,31)/t15-/m0/s1 |
| InChIKey | KYFFKIWAWZGLBL-HNNXBMFYSA-N |
| XLogP | 3.38 |
| TPSA | 107.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|