C21H26ClN5O3 — CID 123810203
5-amino-3-(3-chloro-4-propan-2-yloxyphenyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrazole-4-carboxamide (PubChem CID 123810203) has the molecular formula C21H26ClN5O3 and a molecular weight of 431.92 g/mol. Its IUPAC name is 5-amino-3-(3-chloro-4-propan-2-yloxyphenyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-(3-chloro-4-propan-2-yloxyphenyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123810203 |
| Molecular Formula | C21H26ClN5O3 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 5-amino-3-(3-chloro-4-propan-2-yloxyphenyl)-1-(1-prop-2-enoylpiperidin-4-yl)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1CCC(n2nc(-c3ccc(OC(C)C)c(Cl)c3)c(C(N)=O)c2N)CC1 |
| InChI | InChI=1S/C21H26ClN5O3/c1-4-17(28)26-9-7-14(8-10-26)27-20(23)18(21(24)29)19(25-27)13-5-6-16(15(22)11-13)30-12(2)3/h4-6,11-12,14H,1,7-10,23H2,2-3H3,(H2,24,29) |
| InChIKey | HIPWOGLCWLNSHU-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 116.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|