C24H25N5O5 — CID 129157921
5-amino-1-[(3R)-1-[(Z)-4,4-dihydroxybut-2-enoyl]pyrrolidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-4-carboxamide (PubChem CID 129157921) has the molecular formula C24H25N5O5 and a molecular weight of 463.49 g/mol. Its IUPAC name is 5-amino-1-[(3R)-1-[(Z)-4,4-dihydroxybut-2-enoyl]pyrrolidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[(3R)-1-[(Z)-4,4-dihydroxybut-2-enoyl]pyrrolidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 129157921 |
| Molecular Formula | C24H25N5O5 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 5-amino-1-[(3R)-1-[(Z)-4,4-dihydroxybut-2-enoyl]pyrrolidin-3-yl]-3-(4-phenoxyphenyl)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccccc3)cc2)nn([C@@H]2CCN(C(=O)/C=C\C(O)O)C2)c1N |
| InChI | InChI=1S/C24H25N5O5/c25-23-21(24(26)33)22(15-6-8-18(9-7-15)34-17-4-2-1-3-5-17)27-29(23)16-12-13-28(14-16)19(30)10-11-20(31)32/h1-11,16,20,31-32H,12-14,25H2,(H2,26,33)/b11-10-/t16-/m1/s1 |
| InChIKey | HQHNHXPQQJDJCW-BLIJAFNYSA-N |
| XLogP | 1.66 |
| TPSA | 156.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|