C24H26BrN5O3 — CID 126691079
(E)-1-[(3R)-3-[5-amino-4-[amino(hydroxy)methyl]-3-(4-phenoxyphenyl)pyrazol-1-yl]pyrrolidin-1-yl]-4-bromobut-2-en-1-one (PubChem CID 126691079) has the molecular formula C24H26BrN5O3 and a molecular weight of 512.41 g/mol. Its IUPAC name is (E)-1-[(3R)-3-[5-amino-4-[amino(hydroxy)methyl]-3-(4-phenoxyphenyl)pyrazol-1-yl]pyrrolidin-1-yl]-4-bromobut-2-en-1-one.
| Compound Name | (E)-1-[(3R)-3-[5-amino-4-[amino(hydroxy)methyl]-3-(4-phenoxyphenyl)pyrazol-1-yl]pyrrolidin-1-yl]-4-bromobut-2-en-1-one |
|---|---|
| PubChem CID | 126691079 |
| Molecular Formula | C24H26BrN5O3 |
| Molecular Weight | 512.41 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | (E)-1-[(3R)-3-[5-amino-4-[amino(hydroxy)methyl]-3-(4-phenoxyphenyl)pyrazol-1-yl]pyrrolidin-1-yl]-4-bromobut-2-en-1-one |
| SMILES | Nc1c(C(N)O)c(-c2ccc(Oc3ccccc3)cc2)nn1[C@@H]1CCN(C(=O)/C=C/CBr)C1 |
| InChI | InChI=1S/C24H26BrN5O3/c25-13-4-7-20(31)29-14-12-17(15-29)30-23(26)21(24(27)32)22(28-30)16-8-10-19(11-9-16)33-18-5-2-1-3-6-18/h1-11,17,24,32H,12-15,26-27H2/b7-4+/t17-,24?/m1/s1 |
| InChIKey | YGCOOFQMOYPVHW-WKVMFKSOSA-N |
| XLogP | 3.60 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|