C25H23ClN6O3 — CID 140813258
5-amino-3-[4-(4-chlorophenoxy)phenyl]-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 140813258) has the molecular formula C25H23ClN6O3 and a molecular weight of 490.95 g/mol. Its IUPAC name is 5-amino-3-[4-(4-chlorophenoxy)phenyl]-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-(4-chlorophenoxy)phenyl]-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 140813258 |
| Molecular Formula | C25H23ClN6O3 |
| Molecular Weight | 490.95 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | 5-amino-3-[4-(4-chlorophenoxy)phenyl]-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | [C-]#[N+]/C=C/C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccc(Cl)cc4)cc3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C25H23ClN6O3/c1-29-13-12-21(33)31-14-2-3-18(15-31)32-24(27)22(25(28)34)23(30-32)16-4-8-19(9-5-16)35-20-10-6-17(26)7-11-20/h4-13,18H,2-3,14-15,27H2,(H2,28,34)/b13-12+ |
| InChIKey | MBLQYNOWDVFQLC-OUKQBFOZSA-N |
| XLogP | 4.27 |
| TPSA | 120.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|