C24H24ClFN6O3 — CID 123921715
5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-(4-fluorobut-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 123921715) has the molecular formula C24H24ClFN6O3 and a molecular weight of 498.95 g/mol. Its IUPAC name is 5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-(4-fluorobut-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-(4-fluorobut-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123921715 |
| Molecular Formula | C24H24ClFN6O3 |
| Molecular Weight | 498.95 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-(4-fluorobut-2-enoyl)piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccc(Cl)cn3)cc2)nn(C2CCCN(C(=O)C=CCF)C2)c1N |
| InChI | InChI=1S/C24H24ClFN6O3/c25-16-7-10-19(29-13-16)35-18-8-5-15(6-9-18)22-21(24(28)34)23(27)32(30-22)17-3-2-12-31(14-17)20(33)4-1-11-26/h1,4-10,13,17H,2-3,11-12,14,27H2,(H2,28,34) |
| InChIKey | LXSBUVPAJOBMGO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|