C26H27F2N5O4 — CID 118445271
5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[1-[(E)-5-hydroxypent-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 118445271) has the molecular formula C26H27F2N5O4 and a molecular weight of 511.53 g/mol. Its IUPAC name is 5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[1-[(E)-5-hydroxypent-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[1-[(E)-5-hydroxypent-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118445271 |
| Molecular Formula | C26H27F2N5O4 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.20 |
| IUPAC Name | 5-amino-3-[4-(2,4-difluorophenoxy)phenyl]-1-[1-[(E)-5-hydroxypent-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccc(F)cc3F)cc2)nn(C2CCCN(C(=O)/C=C/CCO)C2)c1N |
| InChI | InChI=1S/C26H27F2N5O4/c27-17-8-11-21(20(28)14-17)37-19-9-6-16(7-10-19)24-23(26(30)36)25(29)33(31-24)18-4-3-12-32(15-18)22(35)5-1-2-13-34/h1,5-11,14,18,34H,2-4,12-13,15,29H2,(H2,30,36)/b5-1+ |
| InChIKey | ARKCKCVBMIRFMC-ORCRQEGFSA-N |
| XLogP | 3.40 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|