C25H22F3N7O3 — CID 123905797
5-amino-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]-3-[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyrazole-4-carboxamide (PubChem CID 123905797) has the molecular formula C25H22F3N7O3 and a molecular weight of 525.49 g/mol. Its IUPAC name is 5-amino-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]-3-[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]-3-[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 123905797 |
| Molecular Formula | C25H22F3N7O3 |
| Molecular Weight | 525.49 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 5-amino-1-[1-[(E)-3-isocyanoprop-2-enoyl]piperidin-3-yl]-3-[4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]phenyl]pyrazole-4-carboxamide |
| SMILES | [C-]#[N+]/C=C/C(=O)N1CCCC(n2nc(-c3ccc(Oc4cccc(C(F)(F)F)n4)cc3)c(C(N)=O)c2N)C1 |
| InChI | InChI=1S/C25H22F3N7O3/c1-31-12-11-20(36)34-13-3-4-16(14-34)35-23(29)21(24(30)37)22(33-35)15-7-9-17(10-8-15)38-19-6-2-5-18(32-19)25(26,27)28/h2,5-12,16H,3-4,13-14,29H2,(H2,30,37)/b12-11+ |
| InChIKey | QJLCVSLGIYIVKZ-VAWYXSNFSA-N |
| XLogP | 4.03 |
| TPSA | 133.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|