C24H25ClN6O4 — CID 118445285
5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-[(E)-4-hydroxybut-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide (PubChem CID 118445285) has the molecular formula C24H25ClN6O4 and a molecular weight of 496.96 g/mol. Its IUPAC name is 5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-[(E)-4-hydroxybut-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-[(E)-4-hydroxybut-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118445285 |
| Molecular Formula | C24H25ClN6O4 |
| Molecular Weight | 496.96 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 5-amino-3-[4-[(5-chloro-2-pyridinyl)oxy]phenyl]-1-[1-[(E)-4-hydroxybut-2-enoyl]piperidin-3-yl]pyrazole-4-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(Oc3ccc(Cl)cn3)cc2)nn(C2CCCN(C(=O)/C=C/CO)C2)c1N |
| InChI | InChI=1S/C24H25ClN6O4/c25-16-7-10-19(28-13-16)35-18-8-5-15(6-9-18)22-21(24(27)34)23(26)31(29-22)17-3-1-11-30(14-17)20(33)4-2-12-32/h2,4-10,13,17,32H,1,3,11-12,14,26H2,(H2,27,34)/b4-2+ |
| InChIKey | LAWDRYYLCRGUCB-DUXPYHPUSA-N |
| XLogP | 2.78 |
| TPSA | 149.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.96 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|