C23H24N6O2 — CID 118445299
5-amino-1-[(3R)-1-cyanopiperidin-3-yl]-3-[4-(4-methylphenoxy)phenyl]pyrazole-4-carboxamide (PubChem CID 118445299) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 5-amino-1-[(3R)-1-cyanopiperidin-3-yl]-3-[4-(4-methylphenoxy)phenyl]pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-[(3R)-1-cyanopiperidin-3-yl]-3-[4-(4-methylphenoxy)phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 118445299 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 5-amino-1-[(3R)-1-cyanopiperidin-3-yl]-3-[4-(4-methylphenoxy)phenyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(Oc2ccc(-c3nn([C@@H]4CCCN(C#N)C4)c(N)c3C(N)=O)cc2)cc1 |
| InChI | InChI=1S/C23H24N6O2/c1-15-4-8-18(9-5-15)31-19-10-6-16(7-11-19)21-20(23(26)30)22(25)29(27-21)17-3-2-12-28(13-17)14-24/h4-11,17H,2-3,12-13,25H2,1H3,(H2,26,30)/t17-/m1/s1 |
| InChIKey | GFYODMNCRXIUIK-QGZVFWFLSA-N |
| XLogP | 3.45 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|