C22H22ClFN6O2 — CID 123929638
3-[5-amino-4-[amino(hydroxy)methyl]-3-[4-(2-chloro-6-fluorophenoxy)phenyl]pyrazol-1-yl]piperidine-1-carbonitrile (PubChem CID 123929638) has the molecular formula C22H22ClFN6O2 and a molecular weight of 456.91 g/mol. Its IUPAC name is 3-[5-amino-4-[amino(hydroxy)methyl]-3-[4-(2-chloro-6-fluorophenoxy)phenyl]pyrazol-1-yl]piperidine-1-carbonitrile.
| Compound Name | 3-[5-amino-4-[amino(hydroxy)methyl]-3-[4-(2-chloro-6-fluorophenoxy)phenyl]pyrazol-1-yl]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 123929638 |
| Molecular Formula | C22H22ClFN6O2 |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 3-[5-amino-4-[amino(hydroxy)methyl]-3-[4-(2-chloro-6-fluorophenoxy)phenyl]pyrazol-1-yl]piperidine-1-carbonitrile |
| SMILES | N#CN1CCCC(n2nc(-c3ccc(Oc4c(F)cccc4Cl)cc3)c(C(N)O)c2N)C1 |
| InChI | InChI=1S/C22H22ClFN6O2/c23-16-4-1-5-17(24)20(16)32-15-8-6-13(7-9-15)19-18(22(27)31)21(26)30(28-19)14-3-2-10-29(11-14)12-25/h1,4-9,14,22,31H,2-3,10-11,26-27H2 |
| InChIKey | SECASXUIWQCJKK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|