C25H27N5O2 — CID 144847053
5-amino-1-(1-methylpiperidin-3-yl)-3-(4-phenoxyphenyl)pyrazole-4-carbonitrile;prop-2-enal (PubChem CID 144847053) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 5-amino-1-(1-methylpiperidin-3-yl)-3-(4-phenoxyphenyl)pyrazole-4-carbonitrile;prop-2-enal.
| Compound Name | 5-amino-1-(1-methylpiperidin-3-yl)-3-(4-phenoxyphenyl)pyrazole-4-carbonitrile;prop-2-enal |
|---|---|
| PubChem CID | 144847053 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 5-amino-1-(1-methylpiperidin-3-yl)-3-(4-phenoxyphenyl)pyrazole-4-carbonitrile;prop-2-enal |
| SMILES | C=CC=O.CN1CCCC(n2nc(-c3ccc(Oc4ccccc4)cc3)c(C#N)c2N)C1 |
| InChI | InChI=1S/C22H23N5O.C3H4O/c1-26-13-5-6-17(15-26)27-22(24)20(14-23)21(25-27)16-9-11-19(12-10-16)28-18-7-3-2-4-8-18;1-2-3-4/h2-4,7-12,17H,5-6,13,15,24H2,1H3;2-3H,1H2 |
| InChIKey | DUJDFFWEEIXUPP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 97.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|