C22H24N6O — CID 126541005
(3R)-3-[5-amino-4-(aminomethyl)-3-(4-phenoxyphenyl)pyrazol-1-yl]piperidine-1-carbonitrile (PubChem CID 126541005) has the molecular formula C22H24N6O and a molecular weight of 388.48 g/mol. Its IUPAC name is (3R)-3-[5-amino-4-(aminomethyl)-3-(4-phenoxyphenyl)pyrazol-1-yl]piperidine-1-carbonitrile.
| Compound Name | (3R)-3-[5-amino-4-(aminomethyl)-3-(4-phenoxyphenyl)pyrazol-1-yl]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 126541005 |
| Molecular Formula | C22H24N6O |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | (3R)-3-[5-amino-4-(aminomethyl)-3-(4-phenoxyphenyl)pyrazol-1-yl]piperidine-1-carbonitrile |
| SMILES | N#CN1CCC[C@@H](n2nc(-c3ccc(Oc4ccccc4)cc3)c(CN)c2N)C1 |
| InChI | InChI=1S/C22H24N6O/c23-13-20-21(26-28(22(20)25)17-5-4-12-27(14-17)15-24)16-8-10-19(11-9-16)29-18-6-2-1-3-7-18/h1-3,6-11,17H,4-5,12-14,23,25H2/t17-/m1/s1 |
| InChIKey | LASGVIVOYAUOJQ-QGZVFWFLSA-N |
| XLogP | 3.50 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|