C22H25N6OP — CID 123777648
5-amino-3-(6-phenoxy-3-pyridinyl)-1-(1-phosphanylazocan-3-yl)pyrazole-4-carbonitrile (PubChem CID 123777648) has the molecular formula C22H25N6OP and a molecular weight of 420.46 g/mol. Its IUPAC name is 5-amino-3-(6-phenoxy-3-pyridinyl)-1-(1-phosphanylazocan-3-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-(6-phenoxy-3-pyridinyl)-1-(1-phosphanylazocan-3-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 123777648 |
| Molecular Formula | C22H25N6OP |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 5-amino-3-(6-phenoxy-3-pyridinyl)-1-(1-phosphanylazocan-3-yl)pyrazole-4-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Oc3ccccc3)nc2)nn(C2CCCCCN(P)C2)c1N |
| InChI | InChI=1S/C22H25N6OP/c23-13-19-21(16-10-11-20(25-14-16)29-18-8-4-1-5-9-18)26-28(22(19)24)17-7-3-2-6-12-27(30)15-17/h1,4-5,8-11,14,17H,2-3,6-7,12,15,24,30H2 |
| InChIKey | FMNJQGZLSAJOJV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|