C15H20N5P — CID 144618614
5-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(1-phosphanylpiperidin-3-yl)pyrazole-4-carbonitrile (PubChem CID 144618614) has the molecular formula C15H20N5P and a molecular weight of 301.33 g/mol. Its IUPAC name is 5-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(1-phosphanylpiperidin-3-yl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(1-phosphanylpiperidin-3-yl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 144618614 |
| Molecular Formula | C15H20N5P |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 5-amino-3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(1-phosphanylpiperidin-3-yl)pyrazole-4-carbonitrile |
| SMILES | C=C/C=C(\C=C)c1nn(C2CCCN(P)C2)c(N)c1C#N |
| InChI | InChI=1S/C15H20N5P/c1-3-6-11(4-2)14-13(9-16)15(17)20(18-14)12-7-5-8-19(21)10-12/h3-4,6,12H,1-2,5,7-8,10,17,21H2/b11-6+ |
| InChIKey | HQFDNPONITVFNF-IZZDOVSWSA-N |
| XLogP | 2.52 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|