C23H27N7O — CID 167042286
1-(1-aminopiperidin-3-yl)-3-[(3E,5E)-6-phenoxyhepta-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 167042286) has the molecular formula C23H27N7O and a molecular weight of 417.52 g/mol. Its IUPAC name is 1-(1-aminopiperidin-3-yl)-3-[(3E,5E)-6-phenoxyhepta-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-(1-aminopiperidin-3-yl)-3-[(3E,5E)-6-phenoxyhepta-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167042286 |
| Molecular Formula | C23H27N7O |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-(1-aminopiperidin-3-yl)-3-[(3E,5E)-6-phenoxyhepta-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | C=C/C(=C\C=C(/C)Oc1ccccc1)c1nn(C2CCCN(N)C2)c2ncnc(N)c12 |
| InChI | InChI=1S/C23H27N7O/c1-3-17(12-11-16(2)31-19-9-5-4-6-10-19)21-20-22(24)26-15-27-23(20)30(28-21)18-8-7-13-29(25)14-18/h3-6,9-12,15,18H,1,7-8,13-14,25H2,2H3,(H2,24,26,27)/b16-11+,17-12+ |
| InChIKey | JQLDHGOMYIHJBN-MAEUFBSDSA-N |
| XLogP | 3.47 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|