C23H24N6O2 — CID 141496659
1-[(3R)-3-[4-amino-3-(3-phenylmethoxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 141496659) has the molecular formula C23H24N6O2 and a molecular weight of 416.49 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-(3-phenylmethoxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-(3-phenylmethoxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 141496659 |
| Molecular Formula | C23H24N6O2 |
| Molecular Weight | 416.49 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-(3-phenylmethoxyprop-1-ynyl)pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(C#CCOCc3ccccc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C23H24N6O2/c1-2-20(30)28-12-6-10-18(14-28)29-23-21(22(24)25-16-26-23)19(27-29)11-7-13-31-15-17-8-4-3-5-9-17/h2-5,8-9,16,18H,1,6,10,12-15H2,(H2,24,25,26)/t18-/m1/s1 |
| InChIKey | DSMPBHBZUJUNJZ-GOSISDBHSA-N |
| XLogP | 2.33 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|