C22H20ClFN6O2 — CID 175018855
1-[3-[4-amino-3-[3-(3-chloro-2-fluorophenoxy)prop-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 175018855) has the molecular formula C22H20ClFN6O2 and a molecular weight of 454.89 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[3-(3-chloro-2-fluorophenoxy)prop-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[3-(3-chloro-2-fluorophenoxy)prop-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175018855 |
| Molecular Formula | C22H20ClFN6O2 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 1-[3-[4-amino-3-[3-(3-chloro-2-fluorophenoxy)prop-1-ynyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(C#CCOc3cccc(Cl)c3F)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C22H20ClFN6O2/c1-2-18(31)29-10-4-6-14(12-29)30-22-19(21(25)26-13-27-22)16(28-30)8-5-11-32-17-9-3-7-15(23)20(17)24/h2-3,7,9,13-14H,1,4,6,10-12H2,(H2,25,26,27) |
| InChIKey | JFNDXVLNAFKEJJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|