C10H13N5O2 — CID 82589899
5-amino-4-cyano-1-piperidin-4-ylpyrazole-3-carboxylic acid (PubChem CID 82589899) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 5-amino-4-cyano-1-piperidin-4-ylpyrazole-3-carboxylic acid.
| Compound Name | 5-amino-4-cyano-1-piperidin-4-ylpyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 82589899 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 5-amino-4-cyano-1-piperidin-4-ylpyrazole-3-carboxylic acid |
| SMILES | N#Cc1c(C(=O)O)nn(C2CCNCC2)c1N |
| InChI | InChI=1S/C10H13N5O2/c11-5-7-8(10(16)17)14-15(9(7)12)6-1-3-13-4-2-6/h6,13H,1-4,12H2,(H,16,17) |
| InChIKey | QKCSTZVJBTZXOL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 116.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |